C12H12 — CID 71437852
bicyclo[5.4.1]dodeca-1(11),2,5,7,9-pentaene (PubChem CID 71437852) has the molecular formula C12H12 and a molecular weight of 156.23 g/mol. Its IUPAC name is bicyclo[5.4.1]dodeca-1(11),2,5,7,9-pentaene.
| Compound Name | bicyclo[5.4.1]dodeca-1(11),2,5,7,9-pentaene |
|---|---|
| PubChem CID | 71437852 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | bicyclo[5.4.1]dodeca-1(11),2,5,7,9-pentaene |
| SMILES | C1=CC=C2C=CCC=CC(=C1)C2 |
| InChI | InChI=1S/C12H12/c1-2-6-11-8-4-5-9-12(10-11)7-3-1/h2-9H,1,10H2 |
| InChIKey | PJQWLKKPIOOZAD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |