C25H18Cl2O2 — CID 20704497
(2E,4E,6Z,14E,16E,18Z)-9,12-dichlorobicyclo[18.4.1]pentacosa-1(24),2,4,6,9,10,11,14,16,18,20,22-dodecaene-8,13-dione (PubChem CID 20704497) has the molecular formula C25H18Cl2O2 and a molecular weight of 421.32 g/mol. Its IUPAC name is (2E,4E,6Z,14E,16E,18Z)-9,12-dichlorobicyclo[18.4.1]pentacosa-1(24),2,4,6,9,10,11,14,16,18,20,22-dodecaene-8,13-dione.
| Compound Name | (2E,4E,6Z,14E,16E,18Z)-9,12-dichlorobicyclo[18.4.1]pentacosa-1(24),2,4,6,9,10,11,14,16,18,20,22-dodecaene-8,13-dione |
|---|---|
| PubChem CID | 20704497 |
| Molecular Formula | C25H18Cl2O2 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | (2E,4E,6Z,14E,16E,18Z)-9,12-dichlorobicyclo[18.4.1]pentacosa-1(24),2,4,6,9,10,11,14,16,18,20,22-dodecaene-8,13-dione |
| SMILES | O=C1/C=C\C=C\C=C\C2=CC=CC=C(/C=C\C=C\C=C\C(=O)C(Cl)=C=C=C1Cl)C2 |
| InChI | InChI=1S/C25H18Cl2O2/c26-22-17-18-23(27)25(29)16-8-4-2-6-12-21-14-10-9-13-20(19-21)11-5-1-3-7-15-24(22)28/h1-16H,19H2/b3-1+,4-2+,11-5-,12-6+,15-7+,16-8-,23-22- |
| InChIKey | GPINGUGTFXSOBE-RDLZLHILSA-N |
| XLogP | 6.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |