C17H12 — CID 134897862
tetracyclo[9.5.1.02,9.03,8]heptadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 134897862) has the molecular formula C17H12 and a molecular weight of 216.28 g/mol. Its IUPAC name is tetracyclo[9.5.1.02,9.03,8]heptadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | tetracyclo[9.5.1.02,9.03,8]heptadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 134897862 |
| Molecular Formula | C17H12 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | tetracyclo[9.5.1.02,9.03,8]heptadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | C1=C2C(=C3/C=C/C=C\C=C\1C3)c1ccccc12 |
| InChI | InChI=1S/C17H12/c1-2-6-12-10-13(7-3-1)17-15-9-5-4-8-14(15)16(17)11-12/h1-9,11H,10H2/b2-1-,3-1-,6-2-,7-3+,12-6+,13-7- |
| InChIKey | YZSYOMNTPKSMKJ-UTMXFVGFSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |