C23H14O2 — CID 101357133
pentacyclo[16.4.1.03,16.05,14.06,11]tricosa-1(22),2,4,6,8,10,14,16,18,20-decaene-12,13-dione (PubChem CID 101357133) has the molecular formula C23H14O2 and a molecular weight of 322.36 g/mol. Its IUPAC name is pentacyclo[16.4.1.03,16.05,14.06,11]tricosa-1(22),2,4,6,8,10,14,16,18,20-decaene-12,13-dione.
| Compound Name | pentacyclo[16.4.1.03,16.05,14.06,11]tricosa-1(22),2,4,6,8,10,14,16,18,20-decaene-12,13-dione |
|---|---|
| PubChem CID | 101357133 |
| Molecular Formula | C23H14O2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | pentacyclo[16.4.1.03,16.05,14.06,11]tricosa-1(22),2,4,6,8,10,14,16,18,20-decaene-12,13-dione |
| SMILES | O=C1C(=O)c2cc3c(cc2-c2ccccc21)=CC1=CC=CC=C(C=3)C1 |
| InChI | InChI=1S/C23H14O2/c24-22-19-8-4-3-7-18(19)20-12-16-10-14-5-1-2-6-15(9-14)11-17(16)13-21(20)23(22)25/h1-8,10-13H,9H2 |
| InChIKey | LVJLTUOBWHBBLI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|