C12H9I — CID 156755901
3λ3-iodatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 156755901) has the molecular formula C12H9I and a molecular weight of 280.11 g/mol. Its IUPAC name is 3λ3-iodatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 3λ3-iodatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 156755901 |
| Molecular Formula | C12H9I |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 3λ3-iodatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | C1=CC2=C(I=C1)c1ccccc1C2 |
| InChI | InChI=1S/C12H9I/c1-2-6-11-9(4-1)8-10-5-3-7-13-12(10)11/h1-7H,8H2 |
| InChIKey | BKDVZRITNQUPGK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|