C19H26 — CID 145348138
ethane;(7R)-7-methyl-7,10-dihydrobenzo[a]azulene (PubChem CID 145348138) has the molecular formula C19H26 and a molecular weight of 254.42 g/mol. Its IUPAC name is ethane;(7R)-7-methyl-7,10-dihydrobenzo[a]azulene.
| Compound Name | ethane;(7R)-7-methyl-7,10-dihydrobenzo[a]azulene |
|---|---|
| PubChem CID | 145348138 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | ethane;(7R)-7-methyl-7,10-dihydrobenzo[a]azulene |
| SMILES | CC.CC.C[C@@H]1C=CC2=C(C=C1)c1ccccc1C2 |
| InChI | InChI=1S/C15H14.2C2H6/c1-11-6-8-13-10-12-4-2-3-5-14(12)15(13)9-7-11;2*1-2/h2-9,11H,10H2,1H3;2*1-2H3/t11-;;/m1../s1 |
| InChIKey | CDLCRYZJMCNIHE-NVJADKKVSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |