C14H11N — CID 138376849
(3Z,5Z)-11H-indeno[2,1-c]azocine (PubChem CID 138376849) has the molecular formula C14H11N and a molecular weight of 193.25 g/mol. Its IUPAC name is (3Z,5Z)-11H-indeno[2,1-c]azocine.
| Compound Name | (3Z,5Z)-11H-indeno[2,1-c]azocine |
|---|---|
| PubChem CID | 138376849 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (3Z,5Z)-11H-indeno[2,1-c]azocine |
| SMILES | C1=C\N=C/C2=C(\C=C/1)c1ccccc1C2 |
| InChI | InChI=1S/C14H11N/c1-2-6-13-11(5-1)9-12-10-15-8-4-3-7-14(12)13/h1-8,10H,9H2/b4-3-,7-3-,8-4-,12-10-,14-7+,15-8-,15-10- |
| InChIKey | SWOOTKMCPMSERF-DLJRCJLKSA-N |
| XLogP | 3.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |