C18H22 — CID 143010271
9,9-dimethyl-10H-benzo[a]azulene;ethane (PubChem CID 143010271) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is 9,9-dimethyl-10H-benzo[a]azulene;ethane.
| Compound Name | 9,9-dimethyl-10H-benzo[a]azulene;ethane |
|---|---|
| PubChem CID | 143010271 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 9,9-dimethyl-10H-benzo[a]azulene;ethane |
| SMILES | CC.CC1(C)C=CC=CC2=C1Cc1ccccc12 |
| InChI | InChI=1S/C16H16.C2H6/c1-16(2)10-6-5-9-14-13-8-4-3-7-12(13)11-15(14)16;1-2/h3-10H,11H2,1-2H3;1-2H3 |
| InChIKey | NBRFIBDZPSVHMQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |