C19H22O — CID 151062936
13-tert-butyl-10,12-dimethyl-11-oxatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,13-pentaene (PubChem CID 151062936) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 13-tert-butyl-10,12-dimethyl-11-oxatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,13-pentaene.
| Compound Name | 13-tert-butyl-10,12-dimethyl-11-oxatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,13-pentaene |
|---|---|
| PubChem CID | 151062936 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 13-tert-butyl-10,12-dimethyl-11-oxatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,13-pentaene |
| SMILES | CC(C)(C)C1=CC2=C(Cc3ccccc32)C2(C)OC12C |
| InChI | InChI=1S/C19H22O/c1-17(2,3)16-11-14-13-9-7-6-8-12(13)10-15(14)18(4)19(16,5)20-18/h6-9,11H,10H2,1-5H3 |
| InChIKey | MGNXUWGSVOTWFN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|