C8H6S — CID 54565931
bicyclo[4.2.0]octa-1,3,5-triene-7-thione (PubChem CID 54565931) has the molecular formula C8H6S and a molecular weight of 134.20 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1,3,5-triene-7-thione.
| Compound Name | bicyclo[4.2.0]octa-1,3,5-triene-7-thione |
|---|---|
| PubChem CID | 54565931 |
| Molecular Formula | C8H6S |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | bicyclo[4.2.0]octa-1,3,5-triene-7-thione |
| SMILES | S=C1Cc2ccccc21 |
| InChI | InChI=1S/C8H6S/c9-8-5-6-3-1-2-4-7(6)8/h1-4H,5H2 |
| InChIKey | RGNWMJZUQVKBNC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|