C11H10O2 — CID 146382501
1H-benzo[7]annulene-1,5-diol (PubChem CID 146382501) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 1H-benzo[7]annulene-1,5-diol.
| Compound Name | 1H-benzo[7]annulene-1,5-diol |
|---|---|
| PubChem CID | 146382501 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 1H-benzo[7]annulene-1,5-diol |
| SMILES | OC1=CC=CC=C2C1=CC=CC2O |
| InChI | InChI=1S/C11H10O2/c12-10-6-2-1-4-8-9(10)5-3-7-11(8)13/h1-7,11-13H |
| InChIKey | QWXUSFOQSLQEEJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |