C12H16O4 — CID 159375181
benzene-1,4-diol;cyclohex-2-ene-1,4-diol (PubChem CID 159375181) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is benzene-1,4-diol;cyclohex-2-ene-1,4-diol.
| Compound Name | benzene-1,4-diol;cyclohex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 159375181 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | benzene-1,4-diol;cyclohex-2-ene-1,4-diol |
| SMILES | OC1C=CC(O)CC1.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H10O2.C6H6O2/c2*7-5-1-2-6(8)4-3-5/h1-2,5-8H,3-4H2;1-4,7-8H |
| InChIKey | LKFLCQKAVOUFIR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|