About 5-fluoro-6-methylidenecyclohexa-1,3-dien-1-ol
5-fluoro-6-methylidenecyclohexa-1,3-dien-1-ol (PubChem CID 123419715) has the molecular formula C7H7FO
and a molecular weight of 126.13 g/mol. Its IUPAC name is 5-fluoro-6-methylidenecyclohexa-1,3-dien-1-ol.
Analyze 5-fluoro-6-methylidenecyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-methylidenecyclohexa-1,3-dien-1-ol?
The IUPAC name of 5-fluoro-6-methylidenecyclohexa-1,3-dien-1-ol (CID 123419715) is 5-fluoro-6-methylidenecyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 5-fluoro-6-methylidenecyclohexa-1,3-dien-1-ol?
The canonical SMILES for 5-fluoro-6-methylidenecyclohexa-1,3-dien-1-ol is C=C1C(O)=CC=CC1F.
What is the InChIKey of 5-fluoro-6-methylidenecyclohexa-1,3-dien-1-ol?
The InChIKey is KSYGXIBMEWADJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FO/c1-5-6(8)3-2-4-7(5)9/h2-4,6,9H,1H2.
What are the key properties of 5-fluoro-6-methylidenecyclohexa-1,3-dien-1-ol?
5-fluoro-6-methylidenecyclohexa-1,3-dien-1-ol has a molecular weight of 126.13 g/mol, XLogP of 1.89, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-methylidenecyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 123419715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).