C10H14O — CID 144507325
ethene;5-methylcyclohepta-1,3,6-trien-1-ol (PubChem CID 144507325) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is ethene;5-methylcyclohepta-1,3,6-trien-1-ol.
| Compound Name | ethene;5-methylcyclohepta-1,3,6-trien-1-ol |
|---|---|
| PubChem CID | 144507325 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | ethene;5-methylcyclohepta-1,3,6-trien-1-ol |
| SMILES | C=C.CC1C=CC=C(O)C=C1 |
| InChI | InChI=1S/C8H10O.C2H4/c1-7-3-2-4-8(9)6-5-7;1-2/h2-7,9H,1H3;1-2H2 |
| InChIKey | RZBWYBNAYSLLJK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|