C15H16S2 — CID 130413529
(7R)-7-methyl-3-[(4-methylphenyl)disulfanyl]cyclohepta-1,3,5-triene (PubChem CID 130413529) has the molecular formula C15H16S2 and a molecular weight of 260.43 g/mol. Its IUPAC name is (7R)-7-methyl-3-[(4-methylphenyl)disulfanyl]cyclohepta-1,3,5-triene.
| Compound Name | (7R)-7-methyl-3-[(4-methylphenyl)disulfanyl]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 130413529 |
| Molecular Formula | C15H16S2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (7R)-7-methyl-3-[(4-methylphenyl)disulfanyl]cyclohepta-1,3,5-triene |
| SMILES | Cc1ccc(SSC2=CC=C[C@@H](C)C=C2)cc1 |
| InChI | InChI=1S/C15H16S2/c1-12-4-3-5-14(9-6-12)16-17-15-10-7-13(2)8-11-15/h3-12H,1-2H3/t12-/m1/s1 |
| InChIKey | SWBJCNPOQDWXQF-GFCCVEGCSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|