C18H22O2S4 — CID 14063917
(2R,3R)-1,4-bis[(4-methylphenyl)disulfanyl]butane-2,3-diol (PubChem CID 14063917) has the molecular formula C18H22O2S4 and a molecular weight of 398.64 g/mol. Its IUPAC name is (2R,3R)-1,4-bis[(4-methylphenyl)disulfanyl]butane-2,3-diol.
| Compound Name | (2R,3R)-1,4-bis[(4-methylphenyl)disulfanyl]butane-2,3-diol |
|---|---|
| PubChem CID | 14063917 |
| Molecular Formula | C18H22O2S4 |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | (2R,3R)-1,4-bis[(4-methylphenyl)disulfanyl]butane-2,3-diol |
| SMILES | Cc1ccc(SSC[C@H](O)[C@@H](O)CSSc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H22O2S4/c1-13-3-7-15(8-4-13)23-21-11-17(19)18(20)12-22-24-16-9-5-14(2)6-10-16/h3-10,17-20H,11-12H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | FMZZGVNNDQNDED-ROUUACIJSA-N |
| XLogP | 5.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|