C14H14S — CID 86020256
7-(4-methylphenyl)sulfanylcyclohepta-1,3,5-triene (PubChem CID 86020256) has the molecular formula C14H14S and a molecular weight of 214.33 g/mol. Its IUPAC name is 7-(4-methylphenyl)sulfanylcyclohepta-1,3,5-triene.
| Compound Name | 7-(4-methylphenyl)sulfanylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 86020256 |
| Molecular Formula | C14H14S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 7-(4-methylphenyl)sulfanylcyclohepta-1,3,5-triene |
| SMILES | Cc1ccc(SC2C=CC=CC=C2)cc1 |
| InChI | InChI=1S/C14H14S/c1-12-8-10-14(11-9-12)15-13-6-4-2-3-5-7-13/h2-11,13H,1H3 |
| InChIKey | YUYIMHIMMFLDOA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |