C12H18N2S — CID 138059061
3,5-dimethyl-4-(4-methylphenyl)sulfanylpyrazolidine (PubChem CID 138059061) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 3,5-dimethyl-4-(4-methylphenyl)sulfanylpyrazolidine.
| Compound Name | 3,5-dimethyl-4-(4-methylphenyl)sulfanylpyrazolidine |
|---|---|
| PubChem CID | 138059061 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3,5-dimethyl-4-(4-methylphenyl)sulfanylpyrazolidine |
| SMILES | Cc1ccc(SC2C(C)NNC2C)cc1 |
| InChI | InChI=1S/C12H18N2S/c1-8-4-6-11(7-5-8)15-12-9(2)13-14-10(12)3/h4-7,9-10,12-14H,1-3H3 |
| InChIKey | DSBNVGBZGGFYCE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |