C15H20O3S — CID 132530476
(3aR,5R,6R,6aS)-2,2,5-trimethyl-6-(4-methylphenyl)sulfanyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 132530476) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is (3aR,5R,6R,6aS)-2,2,5-trimethyl-6-(4-methylphenyl)sulfanyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6R,6aS)-2,2,5-trimethyl-6-(4-methylphenyl)sulfanyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 132530476 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (3aR,5R,6R,6aS)-2,2,5-trimethyl-6-(4-methylphenyl)sulfanyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | Cc1ccc(S[C@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]2C)cc1 |
| InChI | InChI=1S/C15H20O3S/c1-9-5-7-11(8-6-9)19-13-10(2)16-14-12(13)17-15(3,4)18-14/h5-8,10,12-14H,1-4H3/t10-,12-,13-,14-/m1/s1 |
| InChIKey | YPKRXWIBXUETGY-FMKGYKFTSA-N |
| XLogP | 3.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |