C11H19NO5 — CID 134275052
(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-amine (PubChem CID 134275052) has the molecular formula C11H19NO5 and a molecular weight of 245.28 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-amine.
| Compound Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-amine |
|---|---|
| PubChem CID | 134275052 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-amine |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](N)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C11H19NO5/c1-10(2)14-5-6(15-10)8(12)13-9-7(5)16-11(3,4)17-9/h5-9H,12H2,1-4H3/t5-,6+,7+,8-,9+/m0/s1 |
| InChIKey | BXYOEXYATMNJCI-JTPBWFLFSA-N |
| XLogP | 0.30 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |