C9H12F2O5 — CID 23235836
(1S,2S,6S,8R,9S)-10,10-difluoro-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-ol (PubChem CID 23235836) has the molecular formula C9H12F2O5 and a molecular weight of 238.19 g/mol. Its IUPAC name is (1S,2S,6S,8R,9S)-10,10-difluoro-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-ol.
| Compound Name | (1S,2S,6S,8R,9S)-10,10-difluoro-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-ol |
|---|---|
| PubChem CID | 23235836 |
| Molecular Formula | C9H12F2O5 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (1S,2S,6S,8R,9S)-10,10-difluoro-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-ol |
| SMILES | CC1(C)O[C@@H]2O[C@H]3[C@H](OC(F)(F)[C@H]3O)[C@@H]2O1 |
| InChI | InChI=1S/C9H12F2O5/c1-8(2)14-5-3-4(13-7(5)16-8)6(12)9(10,11)15-3/h3-7,12H,1-2H3/t3-,4-,5-,6-,7-/m0/s1 |
| InChIKey | NJNMALPWAGGVSX-RRNSMKEASA-N |
| XLogP | 0.22 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |