C27H34 — CID 143203781
ethane;7-methyl-3-[(1Z,3E,5Z)-1-(4-methylphenyl)-3-[(Z)-prop-1-enyl]hepta-1,3,5-trien-2-yl]cyclohepta-1,3,5-triene (PubChem CID 143203781) has the molecular formula C27H34 and a molecular weight of 358.57 g/mol. Its IUPAC name is ethane;7-methyl-3-[(1Z,3E,5Z)-1-(4-methylphenyl)-3-[(Z)-prop-1-enyl]hepta-1,3,5-trien-2-yl]cyclohepta-1,3,5-triene.
| Compound Name | ethane;7-methyl-3-[(1Z,3E,5Z)-1-(4-methylphenyl)-3-[(Z)-prop-1-enyl]hepta-1,3,5-trien-2-yl]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143203781 |
| Molecular Formula | C27H34 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | ethane;7-methyl-3-[(1Z,3E,5Z)-1-(4-methylphenyl)-3-[(Z)-prop-1-enyl]hepta-1,3,5-trien-2-yl]cyclohepta-1,3,5-triene |
| SMILES | C/C=C\C=C(/C=C\C)C(=C\c1ccc(C)cc1)\C1=CC=CC(C)C=C1.CC |
| InChI | InChI=1S/C25H28.C2H6/c1-5-7-11-23(9-6-2)25(19-22-16-13-21(4)14-17-22)24-12-8-10-20(3)15-18-24;1-2/h5-20H,1-4H3;1-2H3/b7-5-,9-6-,23-11+,25-19-; |
| InChIKey | WXQPSTYLHWUTJW-SEONTIGASA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|