About 3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene
3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene (PubChem CID 153344535) has the molecular formula C16H18
and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene |
| PubChem CID | 153344535 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene |
| SMILES | Cc1ccc(C2=CC=CC(C)C=C2)cc1C |
| InChI | InChI=1S/C16H18/c1-12-5-4-6-15(9-7-12)16-10-8-13(2)14(3)11-16/h4-12H,1-3H3 |
| InChIKey | VRFSHDNGYSFJMV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene?
The IUPAC name of 3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene (CID 153344535) is 3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene.
What is the SMILES notation for 3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene?
The canonical SMILES for 3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene is Cc1ccc(C2=CC=CC(C)C=C2)cc1C.
What is the InChIKey of 3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene?
The InChIKey is VRFSHDNGYSFJMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18/c1-12-5-4-6-15(9-7-12)16-10-8-13(2)14(3)11-16/h4-12H,1-3H3.
What are the key properties of 3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene?
3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene has a molecular weight of 210.32 g/mol, XLogP of 4.45, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylphenyl)-7-methylcyclohepta-1,3,5-triene is sourced from PubChem (CID 153344535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).