C13H11NO2 — CID 163428129
8a,9-dihydroacridine-4,5-diol (PubChem CID 163428129) has the molecular formula C13H11NO2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 8a,9-dihydroacridine-4,5-diol.
| Compound Name | 8a,9-dihydroacridine-4,5-diol |
|---|---|
| PubChem CID | 163428129 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 8a,9-dihydroacridine-4,5-diol |
| SMILES | OC1=CC=CC2Cc3cccc(O)c3N=C12 |
| InChI | InChI=1S/C13H11NO2/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14-12(8)10/h1-6,8,15-16H,7H2 |
| InChIKey | AOGGDLBIIPKRMZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |