C9H10ClNO — CID 174954267
1-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol (PubChem CID 174954267) has the molecular formula C9H10ClNO and a molecular weight of 183.64 g/mol. Its IUPAC name is 1-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol.
| Compound Name | 1-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol |
|---|---|
| PubChem CID | 174954267 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 1-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol |
| SMILES | Oc1cccc2c1C(Cl)NCC2 |
| InChI | InChI=1S/C9H10ClNO/c10-9-8-6(4-5-11-9)2-1-3-7(8)12/h1-3,9,11-12H,4-5H2 |
| InChIKey | BNXWKUWSRSELKJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|