C11H13NO — CID 83358351
1-ethenyl-1,2,3,4-tetrahydroisoquinolin-8-ol (PubChem CID 83358351) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-ethenyl-1,2,3,4-tetrahydroisoquinolin-8-ol.
| Compound Name | 1-ethenyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
|---|---|
| PubChem CID | 83358351 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1-ethenyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
| SMILES | C=CC1NCCc2cccc(O)c21 |
| InChI | InChI=1S/C11H13NO/c1-2-9-11-8(6-7-12-9)4-3-5-10(11)13/h2-5,9,12-13H,1,6-7H2 |
| InChIKey | AKJIQKSGFVYENV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|