C11H12FN — CID 83359841
1-ethenyl-5-fluoro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 83359841) has the molecular formula C11H12FN and a molecular weight of 177.22 g/mol. Its IUPAC name is 1-ethenyl-5-fluoro-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-ethenyl-5-fluoro-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 83359841 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 1-ethenyl-5-fluoro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | C=CC1NCCc2c(F)cccc21 |
| InChI | InChI=1S/C11H12FN/c1-2-11-9-4-3-5-10(12)8(9)6-7-13-11/h2-5,11,13H,1,6-7H2 |
| InChIKey | NYGBAFJPKWXYBF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|