C11H12ClN — CID 83358714
8-chloro-1-ethenyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 83358714) has the molecular formula C11H12ClN and a molecular weight of 193.68 g/mol. Its IUPAC name is 8-chloro-1-ethenyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 8-chloro-1-ethenyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 83358714 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 8-chloro-1-ethenyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | C=CC1NCCc2cccc(Cl)c21 |
| InChI | InChI=1S/C11H12ClN/c1-2-10-11-8(6-7-13-10)4-3-5-9(11)12/h2-5,10,13H,1,6-7H2 |
| InChIKey | QEAGVXLTURTFFO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|