C11H15NOS — CID 83358374
1-(1-sulfanylethyl)-1,2,3,4-tetrahydroisoquinolin-8-ol (PubChem CID 83358374) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-(1-sulfanylethyl)-1,2,3,4-tetrahydroisoquinolin-8-ol.
| Compound Name | 1-(1-sulfanylethyl)-1,2,3,4-tetrahydroisoquinolin-8-ol |
|---|---|
| PubChem CID | 83358374 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 1-(1-sulfanylethyl)-1,2,3,4-tetrahydroisoquinolin-8-ol |
| SMILES | CC(S)C1NCCc2cccc(O)c21 |
| InChI | InChI=1S/C11H15NOS/c1-7(14)11-10-8(5-6-12-11)3-2-4-9(10)13/h2-4,7,11-14H,5-6H2,1H3 |
| InChIKey | FPASJYBOJPXPLI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|