About 5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one
5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one (PubChem CID 50877055) has the molecular formula C11H11NO
and a molecular weight of 173.22 g/mol. Its IUPAC name is 5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one.
Molecular Properties
| Compound Name | 5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one |
| PubChem CID | 50877055 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one |
| SMILES | O=C1Cc2cccc3c2C1NCC3 |
| InChI | InChI=1S/C11H11NO/c13-9-6-8-3-1-2-7-4-5-12-11(9)10(7)8/h1-3,11-12H,4-6H2 |
| InChIKey | MZIPIJOWBUMOKZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one?
The IUPAC name of 5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one (CID 50877055) is 5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one.
What is the SMILES notation for 5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one?
The canonical SMILES for 5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one is O=C1Cc2cccc3c2C1NCC3.
What is the InChIKey of 5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one?
The InChIKey is MZIPIJOWBUMOKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c13-9-6-8-3-1-2-7-4-5-12-11(9)10(7)8/h1-3,11-12H,4-6H2.
What are the key properties of 5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one?
5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one has a molecular weight of 173.22 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one is sourced from PubChem (CID 50877055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).