C9H10OSe — CID 140597302
2-methyl-2,3-dihydro-1-benzoselenophen-7-ol (PubChem CID 140597302) has the molecular formula C9H10OSe and a molecular weight of 213.14 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1-benzoselenophen-7-ol.
| Compound Name | 2-methyl-2,3-dihydro-1-benzoselenophen-7-ol |
|---|---|
| PubChem CID | 140597302 |
| Molecular Formula | C9H10OSe |
| Molecular Weight | 213.14 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 2-methyl-2,3-dihydro-1-benzoselenophen-7-ol |
| SMILES | CC1Cc2cccc(O)c2[Se]1 |
| InChI | InChI=1S/C9H10OSe/c1-6-5-7-3-2-4-8(10)9(7)11-6/h2-4,6,10H,5H2,1H3 |
| InChIKey | XMBFXVSSWWZYPP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.14 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|