C6H6F2O — CID 173042954
2,6-difluorocyclohexa-2,4-dien-1-ol (PubChem CID 173042954) has the molecular formula C6H6F2O and a molecular weight of 132.11 g/mol. Its IUPAC name is 2,6-difluorocyclohexa-2,4-dien-1-ol.
| Compound Name | 2,6-difluorocyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 173042954 |
| Molecular Formula | C6H6F2O |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 2,6-difluorocyclohexa-2,4-dien-1-ol |
| SMILES | OC1C(F)=CC=CC1F |
| InChI | InChI=1S/C6H6F2O/c7-4-2-1-3-5(8)6(4)9/h1-4,6,9H |
| InChIKey | LKMNIAJFNINRSV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |