C6H6F2 — CID 22270273
5,6-difluorocyclohexa-1,3-diene (PubChem CID 22270273) has the molecular formula C6H6F2 and a molecular weight of 116.11 g/mol. Its IUPAC name is 5,6-difluorocyclohexa-1,3-diene.
| Compound Name | 5,6-difluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 22270273 |
| Molecular Formula | C6H6F2 |
| Molecular Weight | 116.11 g/mol |
| Exact Mass | 116.04 |
| IUPAC Name | 5,6-difluorocyclohexa-1,3-diene |
| SMILES | FC1C=CC=CC1F |
| InChI | InChI=1S/C6H6F2/c7-5-3-1-2-4-6(5)8/h1-6H |
| InChIKey | BBCHBHSOQDNDDR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.11 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |