C9H12O2 — CID 10582954
(1S,2R)-3-prop-2-enylcyclohexa-3,5-diene-1,2-diol (PubChem CID 10582954) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (1S,2R)-3-prop-2-enylcyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2R)-3-prop-2-enylcyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 10582954 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (1S,2R)-3-prop-2-enylcyclohexa-3,5-diene-1,2-diol |
| SMILES | C=CCC1=CC=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H12O2/c1-2-4-7-5-3-6-8(10)9(7)11/h2-3,5-6,8-11H,1,4H2/t8-,9+/m0/s1 |
| InChIKey | VUGDXOGOJNHFMN-DTWKUNHWSA-N |
| XLogP | 0.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|