C14H13NO2 — CID 101216885
(1S,2R)-3-(1H-indol-2-yl)cyclohexa-3,5-diene-1,2-diol (PubChem CID 101216885) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is (1S,2R)-3-(1H-indol-2-yl)cyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2R)-3-(1H-indol-2-yl)cyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 101216885 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (1S,2R)-3-(1H-indol-2-yl)cyclohexa-3,5-diene-1,2-diol |
| SMILES | O[C@@H]1C(c2cc3ccccc3[nH]2)=CC=C[C@@H]1O |
| InChI | InChI=1S/C14H13NO2/c16-13-7-3-5-10(14(13)17)12-8-9-4-1-2-6-11(9)15-12/h1-8,13-17H/t13-,14+/m0/s1 |
| InChIKey | QUSMFTINUIJGBN-UONOGXRCSA-N |
| XLogP | 1.84 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |