C21H18N2O — CID 146481056
N-[2-(1H-indol-2-yl)cyclohexa-2,4-dien-1-yl]benzamide (PubChem CID 146481056) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[2-(1H-indol-2-yl)cyclohexa-2,4-dien-1-yl]benzamide.
| Compound Name | N-[2-(1H-indol-2-yl)cyclohexa-2,4-dien-1-yl]benzamide |
|---|---|
| PubChem CID | 146481056 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[2-(1H-indol-2-yl)cyclohexa-2,4-dien-1-yl]benzamide |
| SMILES | O=C(NC1CC=CC=C1c1cc2ccccc2[nH]1)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O/c24-21(15-8-2-1-3-9-15)23-19-13-7-5-11-17(19)20-14-16-10-4-6-12-18(16)22-20/h1-12,14,19,22H,13H2,(H,23,24) |
| InChIKey | ARNHRQQBZQSVQR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |