C18H16N2O2 — CID 9159432
N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-1H-indole-2-carboxamide (PubChem CID 9159432) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 9159432 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-1H-indole-2-carboxamide |
| SMILES | O=C(N[C@H]1CCOc2ccccc21)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H16N2O2/c21-18(16-11-12-5-1-3-7-14(12)19-16)20-15-9-10-22-17-8-4-2-6-13(15)17/h1-8,11,15,19H,9-10H2,(H,20,21)/t15-/m0/s1 |
| InChIKey | SQDXTFZZVRSBBQ-HNNXBMFYSA-N |
| XLogP | 3.42 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |