C18H15ClN2O2 — CID 47048118
3-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-1H-indole-2-carboxamide (PubChem CID 47048118) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is 3-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-1H-indole-2-carboxamide.
| Compound Name | 3-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 47048118 |
| Molecular Formula | C18H15ClN2O2 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-1H-indole-2-carboxamide |
| SMILES | O=C(NC1CCOc2ccccc21)c1[nH]c2ccccc2c1Cl |
| InChI | InChI=1S/C18H15ClN2O2/c19-16-12-6-1-3-7-13(12)20-17(16)18(22)21-14-9-10-23-15-8-4-2-5-11(14)15/h1-8,14,20H,9-10H2,(H,21,22) |
| InChIKey | VSFPVGRGURIBMS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |