C14H14N2O2 — CID 95572300
N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-1H-pyrrole-2-carboxamide (PubChem CID 95572300) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 95572300 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(N[C@H]1CCOc2ccccc21)c1ccc[nH]1 |
| InChI | InChI=1S/C14H14N2O2/c17-14(12-5-3-8-15-12)16-11-7-9-18-13-6-2-1-4-10(11)13/h1-6,8,11,15H,7,9H2,(H,16,17)/t11-/m0/s1 |
| InChIKey | UGNNTZDRAXRCQF-NSHDSACASA-N |
| XLogP | 2.27 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |