C15H15N3O3 — CID 99804582
4-N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-1H-pyrrole-2,4-dicarboxamide (PubChem CID 99804582) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 4-N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-1H-pyrrole-2,4-dicarboxamide.
| Compound Name | 4-N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-1H-pyrrole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 99804582 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 4-N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-1H-pyrrole-2,4-dicarboxamide |
| SMILES | NC(=O)c1cc(C(=O)N[C@H]2CCOc3ccccc32)c[nH]1 |
| InChI | InChI=1S/C15H15N3O3/c16-14(19)12-7-9(8-17-12)15(20)18-11-5-6-21-13-4-2-1-3-10(11)13/h1-4,7-8,11,17H,5-6H2,(H2,16,19)(H,18,20)/t11-/m0/s1 |
| InChIKey | FNWKXBJXHHGCRD-NSHDSACASA-N |
| XLogP | 1.37 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |