C17H24O7 — CID 175918031
1,3-bis(prop-2-enyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid;propane-1,2,3-triol (PubChem CID 175918031) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is 1,3-bis(prop-2-enyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid;propane-1,2,3-triol.
| Compound Name | 1,3-bis(prop-2-enyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 175918031 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1,3-bis(prop-2-enyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid;propane-1,2,3-triol |
| SMILES | C=CCC1=CC=CC(CC=C)(C(=O)O)C1C(=O)O.OCC(O)CO |
| InChI | InChI=1S/C14H16O4.C3H8O3/c1-3-6-10-7-5-9-14(8-4-2,13(17)18)11(10)12(15)16;4-1-3(6)2-5/h3-5,7,9,11H,1-2,6,8H2,(H,15,16)(H,17,18);3-6H,1-2H2 |
| InChIKey | WYBLWUXSOPOMGH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|