C13H17NO2 — CID 70187782
6-amino-1,4-bis(prop-2-enyl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 70187782) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 6-amino-1,4-bis(prop-2-enyl)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-amino-1,4-bis(prop-2-enyl)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 70187782 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 6-amino-1,4-bis(prop-2-enyl)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | C=CCC1=CC(N)C(CC=C)(C(=O)O)C=C1 |
| InChI | InChI=1S/C13H17NO2/c1-3-5-10-6-8-13(7-4-2,12(15)16)11(14)9-10/h3-4,6,8-9,11H,1-2,5,7,14H2,(H,15,16) |
| InChIKey | NQLDZVFXBQNKNI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|