C15H28O8 — CID 87114607
hexanedioic acid;propane-1,2,3-triol;3-prop-2-enoxyprop-1-ene (PubChem CID 87114607) has the molecular formula C15H28O8 and a molecular weight of 336.38 g/mol. Its IUPAC name is hexanedioic acid;propane-1,2,3-triol;3-prop-2-enoxyprop-1-ene.
| Compound Name | hexanedioic acid;propane-1,2,3-triol;3-prop-2-enoxyprop-1-ene |
|---|---|
| PubChem CID | 87114607 |
| Molecular Formula | C15H28O8 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | hexanedioic acid;propane-1,2,3-triol;3-prop-2-enoxyprop-1-ene |
| SMILES | C=CCOCC=C.O=C(O)CCCCC(=O)O.OCC(O)CO |
| InChI | InChI=1S/C6H10O4.C6H10O.C3H8O3/c7-5(8)3-1-2-4-6(9)10;1-3-5-7-6-4-2;4-1-3(6)2-5/h1-4H2,(H,7,8)(H,9,10);3-4H,1-2,5-6H2;3-6H,1-2H2 |
| InChIKey | ZZJOJRZQLMYLGB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|