C23H48O6 — CID 174925755
ethenol;octadecanoic acid;propane-1,2,3-triol (PubChem CID 174925755) has the molecular formula C23H48O6 and a molecular weight of 420.63 g/mol. Its IUPAC name is ethenol;octadecanoic acid;propane-1,2,3-triol.
| Compound Name | ethenol;octadecanoic acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 174925755 |
| Molecular Formula | C23H48O6 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | ethenol;octadecanoic acid;propane-1,2,3-triol |
| SMILES | C=CO.CCCCCCCCCCCCCCCCCC(=O)O.OCC(O)CO |
| InChI | InChI=1S/C18H36O2.C3H8O3.C2H4O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;4-1-3(6)2-5;1-2-3/h2-17H2,1H3,(H,19,20);3-6H,1-2H2;2-3H,1H2 |
| InChIKey | CKVNCMLSRWMNIE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|