C11H14O4 — CID 146295493
6-ethenyl-2,6-dimethoxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 146295493) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 6-ethenyl-2,6-dimethoxycyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-ethenyl-2,6-dimethoxycyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 146295493 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 6-ethenyl-2,6-dimethoxycyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | C=CC1(OC)C=CC=C(OC)C1C(=O)O |
| InChI | InChI=1S/C11H14O4/c1-4-11(15-3)7-5-6-8(14-2)9(11)10(12)13/h4-7,9H,1H2,2-3H3,(H,12,13) |
| InChIKey | WDOVVFWUQNPITA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|