C7H10O6S — CID 139603557
1,6-dihydroxy-5-methoxycyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 139603557) has the molecular formula C7H10O6S and a molecular weight of 222.22 g/mol. Its IUPAC name is 1,6-dihydroxy-5-methoxycyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 1,6-dihydroxy-5-methoxycyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 139603557 |
| Molecular Formula | C7H10O6S |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 1,6-dihydroxy-5-methoxycyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | COC1=CC=CC(O)(S(=O)(=O)O)C1O |
| InChI | InChI=1S/C7H10O6S/c1-13-5-3-2-4-7(9,6(5)8)14(10,11)12/h2-4,6,8-9H,1H3,(H,10,11,12) |
| InChIKey | PYHRUDOETRHKLQ-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|