C8H11IO3S — CID 150104265
5-iodo-1,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 150104265) has the molecular formula C8H11IO3S and a molecular weight of 314.14 g/mol. Its IUPAC name is 5-iodo-1,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 5-iodo-1,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 150104265 |
| Molecular Formula | C8H11IO3S |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.95 |
| IUPAC Name | 5-iodo-1,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CC1C(I)=CC=CC1(C)S(=O)(=O)O |
| InChI | InChI=1S/C8H11IO3S/c1-6-7(9)4-3-5-8(6,2)13(10,11)12/h3-6H,1-2H3,(H,10,11,12) |
| InChIKey | DVXFCLLNSFXZLW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|