C27H26O12S4 — CID 150475317
1,5,6-tris-(4-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 150475317) has the molecular formula C27H26O12S4 and a molecular weight of 670.76 g/mol. Its IUPAC name is 1,5,6-tris-(4-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 1,5,6-tris-(4-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 150475317 |
| Molecular Formula | C27H26O12S4 |
| Molecular Weight | 670.76 g/mol |
| Exact Mass | 670.03 |
| IUPAC Name | 1,5,6-tris-(4-methylphenyl)sulfonyloxycyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)OC2=CC=CC(OS(=O)(=O)c3ccc(C)cc3)(S(=O)(=O)O)C2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H26O12S4/c1-19-6-12-22(13-7-19)40(28,29)37-25-5-4-18-27(43(34,35)36,39-42(32,33)24-16-10-21(3)11-17-24)26(25)38-41(30,31)23-14-8-20(2)9-15-23/h4-18,26H,1-3H3,(H,34,35,36) |
| InChIKey | HSQXLTMBPKYXTD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 184.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.76 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|