C8H18N2O8S2 — CID 158590864
1,4-dihydroxycyclohexa-3,5-diene-1,2-disulfonic acid;methanamine (PubChem CID 158590864) has the molecular formula C8H18N2O8S2 and a molecular weight of 334.37 g/mol. Its IUPAC name is 1,4-dihydroxycyclohexa-3,5-diene-1,2-disulfonic acid;methanamine.
| Compound Name | 1,4-dihydroxycyclohexa-3,5-diene-1,2-disulfonic acid;methanamine |
|---|---|
| PubChem CID | 158590864 |
| Molecular Formula | C8H18N2O8S2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 1,4-dihydroxycyclohexa-3,5-diene-1,2-disulfonic acid;methanamine |
| SMILES | CN.CN.O=S(=O)(O)C1C=C(O)C=CC1(O)S(=O)(=O)O |
| InChI | InChI=1S/C6H8O8S2.2CH5N/c7-4-1-2-6(8,16(12,13)14)5(3-4)15(9,10)11;2*1-2/h1-3,5,7-8H,(H,9,10,11)(H,12,13,14);2*2H2,1H3 |
| InChIKey | HUKRXGSYMIJOBG-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|