C6H7LiO5S — CID 172704496
lithium 1,4-dihydroxycyclohexa-2,4-diene-1-sulfonate (PubChem CID 172704496) has the molecular formula C6H7LiO5S and a molecular weight of 198.12 g/mol. Its IUPAC name is lithium 1,4-dihydroxycyclohexa-2,4-diene-1-sulfonate.
| Compound Name | lithium 1,4-dihydroxycyclohexa-2,4-diene-1-sulfonate |
|---|---|
| PubChem CID | 172704496 |
| Molecular Formula | C6H7LiO5S |
| Molecular Weight | 198.12 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | lithium 1,4-dihydroxycyclohexa-2,4-diene-1-sulfonate |
| SMILES | O=S(=O)([O-])C1(O)C=CC(O)=CC1.[Li+] |
| InChI | InChI=1S/C6H8O5S.Li/c7-5-1-3-6(8,4-2-5)12(9,10)11;/h1-3,7-8H,4H2,(H,9,10,11);/q;+1/p-1 |
| InChIKey | DKBULPCELGQKPL-UHFFFAOYSA-M |
| XLogP | -3.37 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.12 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|